75985-52-3

Usage

Uses

Used in Chemical Synthesis:
(2R)-1-[(1R)-1-phenylethyl]-2-aziridinecarboxamide is used as a building block in chemical synthesis for the creation of various complex organic compounds. Its aziridine and carboxamide functional groups offer opportunities for further chemical reactions and modifications, contributing to the development of novel molecules with potential applications in different fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (2R)-1-[(1R)-1-phenylethyl]-2-aziridinecarboxamide is utilized as a potential drug candidate for medicinal chemistry research. Its unique structure and chiral properties make it an interesting target for the development of new therapeutic agents. Further investigation into its biological and pharmacological activities could reveal its potential as a treatment for various diseases and conditions.
Used in Medicinal Chemistry:
(2R)-1-[(1R)-1-phenylethyl]-2-aziridinecarboxamide is employed in medicinal chemistry for the exploration of its reactivity and potential interactions with biological targets. Its chiral center and functional groups provide a basis for studying the effects of stereochemistry on biological activity, which is crucial for understanding the compound's therapeutic potential and optimizing its properties for specific applications.
While the specific applications and biological activities of (2R)-1-[(1R)-1-phenylethyl]-2-aziridinecarboxamide are not widely known, its unique structure and potential reactivity make it an intriguing compound for further investigation in the fields of organic and medicinal chemistry. As research progresses, it may find use in various industries, including pharmaceuticals, agrochemicals, and materials science, depending on the discovery of its specific properties and interactions with biological systems.

InChI:InChI=1/C11H14N2O/c1-8(9-5-3-2-4-6-9)13-7-10(13)11(12)14/h2-6,8,10H,7H2,1H3,(H2,12,14)/t8-,10-,13?/m1/s1

Downstream Products

• 1630013-28-3 C₁₁H₁₅FN₂O 
• 1630013-36-3 C₁₁H₁₅FN₂O 

Relevant academic research and scientific papers

Regioselective and stereospecific synthesis of enantiopure 1,3-oxazolidin-2-ones by intramolecular ring opening of 2-(Boc-aminomethyl) aziridines. Preparation of the antibiotic linezolid

The amide moiety of several enantiopure unactivated 1-aryl- or 1-alkylaziridine-2-carboxamides were reduced and then W-Boc-protected to afford enantiopure 2-(Boc-aminomethyl)aziridines, which were further converted into enantiopure 5-(aminomethyl)-1,3-oxazolidin-2-ones by means of a stereospecific and fully regioselective BF3-Et2O-promoted intramolecular nucleophilic ring opening. One of these oxazolidinones was transformed into the antibiotic linezolid through a Cul-catalyzed N-arylation reaction at its carbamate moiety.

N-Substituted aziridine-2-carboxylic acid derivatives and their immuno-stimulation compositions and methods

A 2-cyanaziridine derivative of the formula STR1 wherein R' is a straight-chained or branched, saturated or mono- or polyunsaturated aliphatic hydrocarbon radical with up to 8 carbon atoms, which is substituted by an aromatic nitrogen-containing heterocyclic radical with 5 or 6 ring-members and 1, 2 or 3 nitrogen atoms optionally substituted by halogen, alkoxy with up to 8 carbon atoms, alkyl with up to 8 carbon atoms, hydroxyl, carbalkoxy with up to 9 carbon atoms, carbamoyl, dialkylamino the alkyl moieties of which having up to 8 carbon atoms, cycloalkylamino, the cycloalkyl moiety having 3-10 carbon atoms, acetylamino, nitro, cyano, acetyl, alkylthio with up to 8 carbon atoms, alkylsulphinyl with up to 8 carbon atoms, alkylsulphonyl with up to 8 carbon atoms, sulphamoyl, phenyl, trifluoromethyl, phenoxy, acetoxy or methylenedioxy; or a pharmacologically acceptable salt thereof, exhibits immune stimulating activity.

N-Substituted aziridine-2-carboxylic acid derivatives for immuno stimulation

Aziridine-2-carboxylic acid derivatives of the formula STR1 wherein X is a carboxyl, nitrile, alkoxycarbonyl or carbamoyl group, and R and R1 are various organic radicals, or pharmacologically acceptable salts thereof, exhibit marked immunostimulant activity, especially in conjunction with added chemotherapeutic agents such as a penicillin, a cephalosporin, a nitrofuran or chloramphenicol. Those compounds are new where X is a cyano group or an alkoxycarbonyl radical and R1 is a hydrogen atom, but R' is not an unsubstituted alkyl radical or an alkyl radical substituted by hydroxyl, alkoxy, dialkylamino, phenyl, 4-chlorophenyl or 4-methoxyphenyl or a vinyl radical substituted by a phenyl or methyl radical, or a cycloalkyl radical, a phenyl a 4-chlorophenyl, a 4-methoxyphenyl, an s-triazinyl or a pyridinyl radical; or where X is a carbamoyl group and R1 is a hydrogen atom, R' is not an unsubstituted cyclohexyl, alkyl or benzyl radical; or where X is a cyano group or an alkoxycarbonyl radical and R1 is a phenyl radical, R' is not an isopropyl, cyclohexyl, phenyl, benzyl or p-chlorobenzyl radical; or where R1 is a methyl radical, R1 is not a benzyl, p-chloro- or p- methoxybenzyl radical.