76044-36-5 Usage
Uses
Used in Pharmaceutical Industry:
5-CHLORO-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE is used as a key intermediate in the synthesis of new compounds for potential drug candidates. Its unique structure allows for the development of compounds with novel biological activities, contributing to the discovery of new therapeutic agents.
Used in Agricultural Industry:
In the agricultural sector, 5-CHLORO-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE is used as a starting material for the synthesis of agrochemicals, particularly fungicides. Its ability to inhibit certain enzymes makes it an important target in the development of effective and environmentally friendly crop protection products.
Used in Medicinal Chemistry Research:
5-CHLORO-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE is utilized as a research compound in medicinal chemistry to explore its potential as an enzyme inhibitor. Its unique structural features make it an attractive candidate for the development of new drugs targeting specific enzymes, which could lead to the discovery of innovative treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 76044-36-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,4 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76044-36:
(7*7)+(6*6)+(5*0)+(4*4)+(3*4)+(2*3)+(1*6)=125
125 % 10 = 5
So 76044-36-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN4/c6-5-7-2-1-4-8-3-9-10(4)5/h1-3H
76044-36-5Relevant academic research and scientific papers
Bis-s-triazolopyrimidine and Some Simple Derivatives
Brown, Desmond J.,Shinozuka, Kazuo
, p. 1147 - 1152 (2007/10/02)
A general synthetic route to the new tricyclic system bis-s-triazolopyrimidine, is reported.Thus the parent heterocycle (11a) is prepared from the key bicyclic intermediate, s-triazolopyrimidin-5-ylamine (7a), through the correspondi
