76044-36-5 Usage
General Description
5-Chloro-[1,2,4]triazolo[1,5-c]pyrimidine is a chemical compound with the molecular formula C4H2ClN5. It is a heterocyclic organic compound that contains a five-membered ring structure consisting of carbon, nitrogen, and chlorine atoms. 5-CHLORO-[1,2,4]TRIAZOLO[1,5-C]PYRIMIDINE is used in various applications in the pharmaceutical and agricultural industries, particularly in the synthesis of potential drug candidates and agrochemicals. Its unique structural properties make it a valuable building block for the development of new compounds with potential biological and chemical activities. Additionally, it is known for its potential as a fungicide and its ability to inhibit certain enzymes, making it an important target in medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 76044-36-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,4 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76044-36:
(7*7)+(6*6)+(5*0)+(4*4)+(3*4)+(2*3)+(1*6)=125
125 % 10 = 5
So 76044-36-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN4/c6-5-7-2-1-4-8-3-9-10(4)5/h1-3H
76044-36-5Relevant articles and documents
Bis-s-triazolopyrimidine and Some Simple Derivatives
Brown, Desmond J.,Shinozuka, Kazuo
, p. 1147 - 1152 (2007/10/02)
A general synthetic route to the new tricyclic system bis-s-triazolopyrimidine, is reported.Thus the parent heterocycle (11a) is prepared from the key bicyclic intermediate, s-triazolopyrimidin-5-ylamine (7a), through the correspondi
