760919-39-9 Usage
Uses
1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) has various applications across different industries, primarily due to its potential biological and pharmacological properties. Some of the key applications are as follows:
Used in Pharmaceutical Industry:
1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) is used as a pharmaceutical compound for its potential biological and pharmacological activities. 1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI)'s unique structure and properties make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Research and Development:
In the field of research and development, 1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) is utilized as a research compound to explore its potential applications and properties. Scientists and researchers investigate its interactions with biological systems, its effects on various diseases, and its potential as a therapeutic agent.
Used in Drug Discovery and Design:
1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) is employed as a starting material or building block in drug discovery and design processes. Its unique structure and potential biological activities make it a valuable component in the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
In the field of chemical synthesis, 1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) serves as an intermediate or reactant in the synthesis of various compounds. Its versatile structure allows for the formation of a wide range of derivatives with potential applications in different industries.
Used in Material Science:
1H-Pyrrolo[2,3-c]pyridine,2,3-dihydro-(9CI) may also find applications in material science, where its unique properties can be harnessed to develop new materials with specific characteristics. For example, its potential use in the development of organic materials, sensors, or other advanced materials is being explored.
Check Digit Verification of cas no
The CAS Registry Mumber 760919-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,0,9,1 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 760919-39:
(8*7)+(7*6)+(6*0)+(5*9)+(4*1)+(3*9)+(2*3)+(1*9)=189
189 % 10 = 9
So 760919-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2/c1-3-8-5-7-6(1)2-4-9-7/h1,3,5,9H,2,4H2
