760941-22-8 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-AMINO-3-(3-THIENYL)-PROPIONIC ACID serves as a crucial building block in the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs and active pharmaceutical ingredients.
Used as a Therapeutic Agent:
(R)-3-AMINO-3-(3-THIENYL)-PROPIONIC ACID has been studied for its potential therapeutic applications, including its use as an anti-inflammatory and analgesic agent. Its ability to modulate inflammatory responses and alleviate pain makes it a promising candidate for the treatment of various conditions.
Used in Scientific Research:
The biochemical and pharmacological properties of (R)-3-AMINO-3-(3-THIENYL)-PROPIONIC ACID also make it a subject of interest in scientific research. Its chiral nature and potential interactions with biological systems provide valuable insights into the development of novel therapeutic strategies and understanding of molecular mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 760941-22-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,0,9,4 and 1 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 760941-22:
(8*7)+(7*6)+(6*0)+(5*9)+(4*4)+(3*1)+(2*2)+(1*2)=168
168 % 10 = 8
So 760941-22-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2S/c8-6(3-7(9)10)5-1-2-11-4-5/h1-2,4,6H,3,8H2,(H,9,10)/t6-/m1/s1
