76099-03-1 Usage
Chemical structure
Contains a benzimidazole ring, an epoxy group, an oxazepine ring, and a thienyl substituent.
Unique chemical properties
The presence of the epoxy group and the oxazepine and benzimidazole rings contribute to the compound's unique chemical properties.
Reactivity
The thienyl substituent contributes to the compound's reactivity.
Potential biological activity
The chemical structure may have potential biological activity due to the presence of the thienyl substituent.
Stability
The presence of the epoxy group may affect the compound's stability and reactivity.
Synthesis
The compound can be synthesized through various chemical reactions, such as condensation, substitution, or addition reactions.
Purity
The purity of the compound can be determined through techniques like chromatography or spectroscopy.
Characterization
The compound's structure and properties can be characterized using techniques like nuclear magnetic resonance (NMR) spectroscopy, infrared (IR) spectroscopy, and mass spectrometry (MS).
Check Digit Verification of cas no
The CAS Registry Mumber 76099-03-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,9 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 76099-03:
(7*7)+(6*6)+(5*0)+(4*9)+(3*9)+(2*0)+(1*3)=151
151 % 10 = 1
So 76099-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N2O2S/c1-2-5-12-11(4-1)16-14-15(13-6-3-7-20-13)18-9-10(19-15)8-17(12)14/h1-7,10H,8-9H2
76099-03-1Relevant academic research and scientific papers
Synthesis and pharmacological properties of analogs of oxapadol, a new analgesic agent
Dostert,Langlois,Guerret,et al.
, p. 199 - 205 (2007/10/02)
A series of various heterocyclic compounds related to Oxapadol was prepared and evaluated for analgesic activity in mice. Some of them possessed significant analgesic effects; their structure activity relationships and chemistry are discussed. These compounds represent, in the authors' opinion, a unique series of analgesic agents.
