76099-05-3 Usage
Chemical Structure
A complex structure containing an epoxy group, a benzimidazole ring, and a 2-chlorophenyl group.
Epoxy group
A three-membered ring containing an oxygen atom and two carbon atoms.
Benzimidazole ring
A fused six-membered nitrogen-containing ring system.
Chlorophenyl group
A phenyl group (a six-membered carbon ring with alternating single and double bonds) with a chlorine atom substitution.
Pharmaceutical industry
The compound may have potential uses in the development of new drugs.
Specific properties
Further study and investigation are needed to understand the compound's properties fully.
Potential uses
Additional research is required to explore the compound's capabilities and potential applications in various fields.
Solubility
Information on solubility is not provided, but it may depend on the polarity of the molecule and the solvent used.
Stability
The stability of the compound is not mentioned, but it could be influenced by factors such as temperature, light exposure, and the presence of other reactive substances.
Reactivity
The reactivity of the compound is not specified, but the presence of the epoxy and benzimidazole groups may suggest potential reactivity with certain reagents or under specific conditions.
Synthesis
The method of synthesis for this compound is not provided, but it likely involves the formation of the benzimidazole ring, introduction of the 2-chlorophenyl group, and the addition of the epoxy group.
Check Digit Verification of cas no
The CAS Registry Mumber 76099-05-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,9 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76099-05:
(7*7)+(6*6)+(5*0)+(4*9)+(3*9)+(2*0)+(1*5)=153
153 % 10 = 3
So 76099-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H13ClN2O2/c18-13-6-2-1-5-12(13)17-16-19-14-7-3-4-8-15(14)20(16)9-11(22-17)10-21-17/h1-8,11H,9-10H2
76099-05-3Relevant articles and documents
Synthesis and pharmacological properties of analogs of oxapadol, a new analgesic agent
Dostert,Langlois,Guerret,et al.
, p. 199 - 205 (2007/10/02)
A series of various heterocyclic compounds related to Oxapadol was prepared and evaluated for analgesic activity in mice. Some of them possessed significant analgesic effects; their structure activity relationships and chemistry are discussed. These compounds represent, in the authors' opinion, a unique series of analgesic agents.