76099-30-4 Usage
Chemical structure
A complex heterocyclic compound consisting of a thiazepine and a benzimidazole ring system, with an epoxy group attached to the thiazepine ring and a dihydrophenyl group.
Aromatic properties
The presence of the dihydrophenyl group contributes to the compound's aromatic properties.
Potential applications
Due to its unique structure and potential biological activity, 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- may have applications in medicinal chemistry and pharmaceutical research.
Biological activity
The specific biological activity of 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- is not mentioned in the provided material, but its unique structure suggests that it may have potential as a therapeutic agent or a lead compound for further drug development.
Stability
The stability of 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- under various conditions (e.g., temperature, pH, etc.) is not provided in the material, but it is an important factor to consider for its potential applications.
Solubility
The solubility of 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- in different solvents is not mentioned in the material, but it is a crucial property for its potential use in pharmaceutical formulations.
Synthesis
The method of synthesis for 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- is not provided in the material, but understanding the synthesis process can help in optimizing its production and exploring its potential applications.
Toxicity
The toxicity of 1,4-Epoxy-1H,3H-(1,4)thiazepino(4,3-a)benzimidazole, 4,5-dihydro-1-phe nyl- is not mentioned in the material, but it is an essential factor to consider for its potential use in medicinal applications.
Check Digit Verification of cas no
The CAS Registry Mumber 76099-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,9 and 9 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 76099-30:
(7*7)+(6*6)+(5*0)+(4*9)+(3*9)+(2*3)+(1*0)=154
154 % 10 = 4
So 76099-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2OS/c1-2-6-12(7-3-1)17-16-18-14-8-4-5-9-15(14)19(16)10-13(20-17)11-21-17/h1-9,13H,10-11H2
76099-30-4Relevant academic research and scientific papers
Synthesis and pharmacological properties of analogs of oxapadol, a new analgesic agent
Dostert,Langlois,Guerret,et al.
, p. 199 - 205 (2007/10/02)
A series of various heterocyclic compounds related to Oxapadol was prepared and evaluated for analgesic activity in mice. Some of them possessed significant analgesic effects; their structure activity relationships and chemistry are discussed. These compounds represent, in the authors' opinion, a unique series of analgesic agents.
