76196-67-3 Usage
Uses
Used in Synthetic Organic Chemistry:
3-Pyridinecarboxylic acid,6-(aminomethyl)-(9CI) is used as a building block for the synthesis of more complex organic molecules. Its unique structure allows for various chemical reactions, making it a versatile component in the creation of new compounds.
Used in Pharmaceutical Sciences:
3-Pyridinecarboxylicacid,6-(aminomethyl)-(9CI) is used as a potential active pharmaceutical ingredient (API) or as an intermediate in the synthesis of drugs. Its basicity and aromaticity contribute to its potential as a therapeutic agent, although further research is needed to fully understand its pharmacological properties and potential applications.
Used in Materials Science:
3-Pyridinecarboxylic acid,6-(aminomethyl)-(9CI) is used as a component in the development of new materials with specific properties. Its chemical structure can influence the physical and chemical characteristics of the materials it is incorporated into, making it a valuable asset in materials science research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 76196-67-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,1,9 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76196-67:
(7*7)+(6*6)+(5*1)+(4*9)+(3*6)+(2*6)+(1*7)=163
163 % 10 = 3
So 76196-67-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c8-3-6-2-1-5(4-9-6)7(10)11/h1-2,4H,3,8H2,(H,10,11)
