7621-74-1 Usage
Uses
Used in Pharmaceutical Industry:
(2-sulfanylcyclopentyl) N-benzoylcarbamate is used as a key intermediate in the synthesis of various pharmaceutical compounds for its unique structural properties and reactivity. Its ability to form carbamates makes it a valuable building block in the development of new drugs.
Used in Organic Synthesis:
In the field of organic synthesis, (2-sulfanylcyclopentyl) N-benzoylcarbamate serves as a versatile reagent for the creation of complex organic molecules. Its cyclopentyl thiol and benzoylcarbamate groups can participate in a range of reactions, making it a useful component in the synthesis of diverse chemical products.
Used in Drug Discovery Studies:
(2-sulfanylcyclopentyl) N-benzoylcarbamate is employed as a potential candidate in drug discovery due to its unique chemical structure. Researchers investigate its interactions with biological targets to identify new therapeutic opportunities and develop novel medications for various diseases.
Used in Chemical Research:
This carbamate derivative is also utilized in academic and industrial chemical research to study its properties, reactivity, and potential applications in material science and other related fields. Understanding its behavior in different conditions can lead to the discovery of new uses and improvements in existing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 7621-74-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,2 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7621-74:
(6*7)+(5*6)+(4*2)+(3*1)+(2*7)+(1*4)=101
101 % 10 = 1
So 7621-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO3S/c15-12(9-5-2-1-3-6-9)14-13(16)17-10-7-4-8-11(10)18/h1-3,5-6,10-11,18H,4,7-8H2,(H,14,15,16)
