762229-49-2 Usage
Uses
Since the provided materials do not specify the applications of 2,6-Difluoro-Benzamidine, I will list potential uses based on its chemical properties and typical applications of similar compounds in the industry.
Used in Pharmaceutical Industry:
2,6-Difluoro-Benzamidine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable building block in the development of new drugs with specific therapeutic effects.
Used in Chemical Research:
2,6-Difluoro-Benzamidine serves as a research compound in various chemical studies. It is used to investigate the properties and reactivity of Benzamidines and their derivatives, contributing to the understanding of their potential applications in different fields.
Used in Material Science:
2,6-Difluoro-Benzamidine may be employed in the development of new materials with specific properties, such as high thermal stability, chemical resistance, or unique electronic characteristics. Its incorporation into polymers or other materials can enhance their performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 762229-49-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,2,2,2 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 762229-49:
(8*7)+(7*6)+(6*2)+(5*2)+(4*2)+(3*9)+(2*4)+(1*9)=172
172 % 10 = 2
So 762229-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F2N2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H3,10,11)
