762262-07-7 Usage
Uses
Used in Pharmaceutical Industry:
4-(Cyclohexylaminocarbonyl)phenylboronic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to facilitate the formation of complex molecular structures. Its reactivity and capacity to form stable complexes make it instrumental in the development of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(cyclohexylaminocarbonyl)phenylboronic acid is utilized as a building block in the synthesis of agrochemicals, contributing to the creation of new compounds with potential applications in pest control and crop protection.
Used in Advanced Materials Industry:
4-(Cyclohexylaminocarbonyl)phenylboronic acid is employed in the development of advanced materials, where its reactivity and complex-forming ability are leveraged to produce materials with unique properties for various high-tech applications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-(cyclohexylaminocarbonyl)phenylboronic acid is used as a research compound for exploring its potential in the development of new therapeutic agents, taking advantage of its versatile chemical properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 762262-07-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,2,2,6 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 762262-07:
(8*7)+(7*6)+(6*2)+(5*2)+(4*6)+(3*2)+(2*0)+(1*7)=157
157 % 10 = 7
So 762262-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H18BNO3/c16-13(15-12-4-2-1-3-5-12)10-6-8-11(9-7-10)14(17)18/h6-9,12,17-18H,1-5H2,(H,15,16)
