762262-11-3 Usage
General Description
3-(2-CYANOETHYLAMINOCARBONYL)PHENYLBORONIC ACID is a chemical compound with the molecular formula C11H13BN2O3. It is a boronic acid derivative that contains a phenyl ring linked to a boronic acid group, along with a cyanoethylaminocarbonyl group attached to the phenyl ring. 3-(2-CYANOETHYLAMINOCARBONYL)PHENYLBORONIC ACID is commonly used in organic synthesis and medicinal chemistry as a reagent for forming carbon-carbon and carbon-heteroatom bonds. Its boronic acid functional group enables it to selectively bind to certain biomolecules, making it useful in the development of pharmaceuticals and other biologically active compounds. Additionally, its cyanoethylaminocarbonyl group provides potential for additional chemical derivatization and modification, making it a versatile building block in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 762262-11-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,2,2,6 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 762262-11:
(8*7)+(7*6)+(6*2)+(5*2)+(4*6)+(3*2)+(2*1)+(1*1)=153
153 % 10 = 3
So 762262-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BN2O3/c12-5-2-6-13-10(14)8-3-1-4-9(7-8)11(15)16/h1,3-4,7,15-16H,2,6H2,(H,13,14)