762287-58-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Fluoro-3-tolylboronic acid is used as a synthetic intermediate for the development of pharmaceuticals. Its ability to form carbon-carbon and carbon-heteroatom bonds makes it a key component in the synthesis of various drug molecules, contributing to the discovery of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Fluoro-3-tolylboronic acid is utilized as a reagent in the synthesis of agrochemicals. Its unique properties allow for the creation of novel compounds with potential applications in crop protection and pest control, enhancing agricultural productivity and sustainability.
Used in Materials Science:
2-Fluoro-3-tolylboronic acid is employed as a building block in the development of new materials. Its reactivity in cross-coupling reactions and other transformations enables the introduction of the 2-fluoro-3-tolyl substituent into various organic molecules, leading to the creation of innovative materials with unique properties and potential applications in various fields.
Used in Organic Synthesis:
As a reagent in organic synthesis, 2-Fluoro-3-tolylboronic acid is used for the formation of carbon-carbon and carbon-heteroatom bonds. Its versatility in cross-coupling reactions and other transformations makes it an essential tool for chemists in the synthesis of complex organic compounds, facilitating the development of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 762287-58-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,2,2,8 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 762287-58:
(8*7)+(7*6)+(6*2)+(5*2)+(4*8)+(3*7)+(2*5)+(1*8)=191
191 % 10 = 1
So 762287-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BFO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,10-11H,1H3
762287-58-1Relevant academic research and scientific papers
General method for the synthesis of substituted phenanthridin-6(5H)-ones using a KOH-mediated anionic ring closure as the key step
Dubost, Emmanuelle,Magnelli, Rosa,Cailly, Thomas,Legay, Rémi,Fabis, Frédéric,Rault, Sylvain
experimental part, p. 5008 - 5016 (2010/08/13)
Substituted phenanthridin-6(5H)-ones were obtained in a two-step procedure involving a Suzuki cross-coupling reaction followed by a KOH-mediated anionic ring closure. The influence of the nature and the position of the substituents on the cyclization step were studied. This methodology offers a general and practical route to diversely substituted phenanthridin-6(5H)-ones.