76306-36-0 Usage
Chemical structure
A tricyclic aromatic hydrocarbon with methyl and methoxy groups at positions 1 and 3, and an ester group at position 4.
Derivation
Derived from carbazole, a tricyclic aromatic hydrocarbon.
Applications
Commonly used in the manufacture of pharmaceuticals, organic semiconductors, and dyes.
Ester group
Presence of the ester group in its structure makes 1,2-Dimethyl-3-methoxy-9H-carbazol-4-ol acetate (ester) highly reactive and versatile for various chemical reactions.
Potential applications
Fields of organic electronics, photovoltaics, and medicinal chemistry.
Hazardous nature
Important to handle with caution, as it can be hazardous if not properly managed in industrial or laboratory settings.
Reactivity
Due to the presence of the ester group, the compound can participate in various chemical reactions, such as hydrolysis, transesterification, and substitution reactions.
Stability
The compound may be sensitive to heat, light, and moisture, requiring proper storage conditions to maintain its stability.
Solubility
It is likely to be soluble in organic solvents such as ethanol, methanol, and dichloromethane, but may have limited solubility in water.
Purity
The purity of the compound is crucial for its performance in various applications, and it should be synthesized and purified using appropriate techniques to minimize impurities.
Synthesis
The compound can be synthesized through various methods, such as the reaction of the corresponding carbazole alcohol with an acetylating agent like acetic anhydride or acetyl chloride.
Characterization
Techniques like nuclear magnetic resonance (NMR), mass spectrometry (MS), and infrared (IR) spectroscopy can be used to confirm the structure and purity of the synthesized compound.
Safety measures
Proper safety measures, including the use of gloves, eye protection, and a fume hood, should be taken when handling 1,2-Dimethyl-3-methoxy-9H-carbazol-4-ol acetate (ester) to minimize the risk of exposure.
Disposal
Dispose of the compound according to local regulations and guidelines for hazardous materials, ensuring that it does not harm the environment or pose a risk to human health.
Check Digit Verification of cas no
The CAS Registry Mumber 76306-36-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,3,0 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76306-36:
(7*7)+(6*6)+(5*3)+(4*0)+(3*6)+(2*3)+(1*6)=130
130 % 10 = 0
So 76306-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO3/c1-9-10(2)16(20-4)17(21-11(3)19)14-12-7-5-6-8-13(12)18-15(9)14/h5-8,18H,1-4H3
76306-36-0Relevant academic research and scientific papers
Transition metal complexes in organic synthesis, part 54.1 Improved total syntheses of the antibiotic alkaloids carbazomycin A and B
Knoelker, Hans-Joachim,Froehner, Wolfgang
, p. 6915 - 6918 (2007/10/03)
Considerably improved total syntheses of the carbazole antibiotics carbazomycin A and B are reported using a convergent iron-mediated one-pot construction of the carbazole framework by oxidative cyclization in the air.
