763109-71-3 Usage
Uses
Used in Biochemistry Research:
5-THIOPHEN-2-YL-ISOXAZOLE-3-CARBOXYLIC ACID is used as a reactant in the cell-free formation of RNA granules with low complexity sequence domain proteins. This application is crucial for understanding the molecular mechanisms underlying the assembly and function of RNA granules, which are implicated in various cellular processes, including stress granule formation and neurodegenerative diseases.
In this context, 5-THIOPHEN-2-YL-ISOXAZOLE-3-CARBOXYLIC ACID plays a significant role in facilitating the interaction between RNA and proteins, leading to the formation of functional RNA granules. This research is essential for advancing our knowledge of RNA biology and its implications in human health and disease.
Check Digit Verification of cas no
The CAS Registry Mumber 763109-71-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,3,1,0 and 9 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 763109-71:
(8*7)+(7*6)+(6*3)+(5*1)+(4*0)+(3*9)+(2*7)+(1*1)=163
163 % 10 = 3
So 763109-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h1-4H,(H,10,11)
