7635-51-0 Usage
Uses
Used in Organic Synthesis:
(2S-trans)-3,4-dimethyl-2-phenylmorpholinium chloride is used as a phase-transfer catalyst to facilitate the transfer of reactants between different phases in organic synthesis. This application aids in increasing the efficiency of specific chemical reactions, making it a valuable tool in the synthesis of various organic compounds.
Used in Asymmetric Synthesis:
In the field of asymmetric synthesis, (2S-trans)-3,4-dimethyl-2-phenylmorpholinium chloride is utilized as a chiral moiety. Its unique structure allows it to contribute to the production of enantiomerically pure compounds, which are essential in the pharmaceutical industry for the development of drugs with improved selectivity and reduced side effects.
Used in the Pharmaceutical Industry:
(2S-trans)-3,4-dimethyl-2-phenylmorpholinium chloride may also find applications in the pharmaceutical industry, where its ability to act as a phase-transfer catalyst and a chiral moiety can be harnessed for the development of new drugs and the improvement of existing synthesis methods. This can lead to more efficient production processes and the creation of innovative medications with better therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 7635-51-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,3 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7635-51:
(6*7)+(5*6)+(4*3)+(3*5)+(2*5)+(1*1)=110
110 % 10 = 0
So 7635-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO.ClH/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;/h3-7,10,12H,8-9H2,1-2H3;1H/t10-,12+;/m0./s1
