76360-89-9 Usage
Uses
Used in Pharmaceutical Industry:
1-isopropyl-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione is used as a potential pharmaceutical agent for its possible biological activity and therapeutic effects on specific diseases. Its unique molecular structure, which includes a seven-membered oxazine ring and a thiomethyl group, suggests that it could have properties relevant to drug discovery and development.
1-isopropyl-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione's potential applications in the pharmaceutical industry may include:
1. As a lead compound in drug discovery for the development of new medications targeting various diseases.
2. For research into its biological activity to understand its mechanism of action and potential therapeutic effects.
3. In the design and synthesis of new drug candidates with improved pharmacological properties, such as increased potency, selectivity, or reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 76360-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,3,6 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 76360-89:
(7*7)+(6*6)+(5*3)+(4*6)+(3*0)+(2*8)+(1*9)=149
149 % 10 = 9
So 76360-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O3S/c1-5(2)13-7-6(8(14)16-10(13)15)4-11-9(12-7)17-3/h4-5H,1-3H3
