76360-93-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-methoxyethyl)-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione is used as a potential pharmaceutical agent for its possible biological activity. 1-(2-methoxyethyl)-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione's heterocyclic nature and functional groups may offer therapeutic benefits, which are yet to be fully understood and explored through scientific research and clinical trials.
Used in Chemical Research:
In the field of chemical research, 1-(2-methoxyethyl)-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione serves as a subject of study for understanding the synthesis, properties, and reactivity of heterocyclic compounds. Its unique structure may provide insights into new chemical reactions and the development of novel synthetic pathways.
Used in Material Science:
1-(2-methoxyethyl)-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione may also find applications in material science, particularly in the development of new materials with specific properties. 1-(2-methoxyethyl)-7-(methylthio)-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione's structural features could contribute to the creation of materials with tailored characteristics for use in various industries, such as electronics, coatings, or advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 76360-93-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,3,6 and 0 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 76360-93:
(7*7)+(6*6)+(5*3)+(4*6)+(3*0)+(2*9)+(1*3)=145
145 % 10 = 5
So 76360-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O4S/c1-16-4-3-13-7-6(8(14)17-10(13)15)5-11-9(12-7)18-2/h5H,3-4H2,1-2H3
