76379-02-7 Usage
Uses
Used in Pharmaceutical Research:
BOC-D-GLU(OME)-OH is used as a key building block for the synthesis of peptides with specific sequence and structural properties. Its protective BOC group and the methoxy group attached to the glutamic acid allow for the creation of peptides with tailored characteristics, making it valuable in the development of new pharmaceutical compounds.
Used in Biological Research:
In biological research, BOC-D-GLU(OME)-OH is utilized for the synthesis of peptides that can be used to study various biological processes and interactions. The specific sequence and structural properties of the peptides created using BOC-D-GLU(OME)-OH can provide insights into the mechanisms of protein function and regulation.
Used in Peptide Drug Development:
BOC-D-GLU(OME)-OH is used as a starting material in the development of peptide-based drugs. Its protective group and methoxy modification enable the synthesis of peptides with desired pharmacological properties, such as enhanced stability, bioavailability, and target specificity. BOC-D-GLU(OME)-OH plays a crucial role in the design and synthesis of novel peptide therapeutics for various diseases and conditions.
Used in Chemical Synthesis:
BOC-D-GLU(OME)-OH is employed as a versatile intermediate in the synthesis of various chemical compounds. Its unique structure and functional groups make it a valuable building block for the preparation of complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Diagnostics and Imaging:
BOC-D-GLU(OME)-OH can be used as a precursor for the synthesis of peptide-based diagnostic agents and imaging probes. The specific sequence and structural properties of the peptides derived from BOC-D-GLU(OME)-OH can be tailored to target specific biological markers or receptors, enabling the development of highly sensitive and selective diagnostic tools.
Check Digit Verification of cas no
The CAS Registry Mumber 76379-02-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,3,7 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 76379-02:
(7*7)+(6*6)+(5*3)+(4*7)+(3*9)+(2*0)+(1*2)=157
157 % 10 = 7
So 76379-02-7 is a valid CAS Registry Number.
InChI:1S/C12H23N.C11H19NO6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-11(2,3)18-10(16)12-7(9(14)15)5-6-8(13)17-4/h11-13H,1-10H2;7H,5-6H2,1-4H3,(H,12,16)(H,14,15)/t;7-/m.0/s1
76379-02-7Relevant academic research and scientific papers
Glucosamine peptide derivatives, their production and use
-
, (2008/06/13)
Novel glucosamine-peptide derivatives of the formula: STR1 wherein m is 0 or 1; n is 0 or an integer of 1 to 9; R is lower alkyl which may be substituted with hydroxyl, or aryl; R1 is hydrogen or acyl having an acyclic hydrocarbon group, the terminal of which may be substituted with a cyclic hydrocarbon group directly, via a carbonyl group or via an oxygen atom; provided that when R1 is hydrogen m is 1; R2 is hydrogen or lower alkyl which may form a ring by connecting its terminal with the α-nitrogen atom when n is 0, or hydrogen when n is an integer of 1 to 9; R3 is hydrogen or lower alkyl; R4 and R5 are each hydrogen or lower alkyl which may be substituted with hydroxyl or benzyloxyl; R6 is hydrogen or lower alkyl; R7 is alkyl which may be substituted with lower alkoxyl or aralkyl; R8 and R9 are each hydrogen, lower alkyl or aralkyl; and (D) and (L) each indicate configurations if their respective carbon atoms are asymmetric; or an acid addition salt thereof, have immunostimulatory activity.
