76391-97-4 Usage
Uses
Used in Pharmaceutical Research:
2-AMINO-1H-BENZIMIDAZOLE-5-CARBOXYLIC ACID is used as a building block for the synthesis of pharmacologically active compounds due to its structural features and potential biological activity. Its presence of both an amino and carboxylic acid group allows for versatile chemical modifications, facilitating the creation of new drug candidates with specific therapeutic properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-AMINO-1H-BENZIMIDAZOLE-5-CARBOXYLIC ACID is utilized as a key intermediate in the development of novel therapeutic agents. Its benzimidazole core is a common structural element in many bioactive molecules, and the presence of the carboxylic acid and amino groups provides opportunities for further functionalization and optimization of drug candidates for various therapeutic applications.
While the provided materials do not specify particular industries or detailed applications, the general uses outlined above are based on the compound's potential in medicinal chemistry and pharmaceutical research. Further research and development would be necessary to explore specific applications and industries where 2-AMINO-1H-BENZIMIDAZOLE-5-CARBOXYLIC ACID could be effectively utilized.
Check Digit Verification of cas no
The CAS Registry Mumber 76391-97-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,3,9 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76391-97:
(7*7)+(6*6)+(5*3)+(4*9)+(3*1)+(2*9)+(1*7)=164
164 % 10 = 4
So 76391-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c9-8-10-5-2-1-4(7(12)13)3-6(5)11-8/h1-3H,(H,12,13)(H3,9,10,11)
