76603-22-0 Usage
General Description
1,2-Dihydro-1-(1-oxopropyl)-3-phenylpyrido(3,4-e)-1,2,4-triazine hydro chloride is a chemical compound with potential pharmacological properties. It is a hydrochloride salt form of a pyrido(3,4-e)-1,2,4-triazine derivative, which is a class of compounds known for their diverse biological activities. This particular compound has a phenyl group attached to the pyrido(3,4-e)-1,2,4-triazine core, and a 1-oxopropyl moiety at the 1 position. It may have applications in pharmaceutical research and medicinal chemistry, as it could potentially exhibit therapeutic effects in various disease conditions. Further studies are needed to explore its specific biological activities and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 76603-22-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,6,0 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 76603-22:
(7*7)+(6*6)+(5*6)+(4*0)+(3*3)+(2*2)+(1*2)=130
130 % 10 = 0
So 76603-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N4O.ClH/c1-2-14(20)19-13-8-9-16-10-12(13)17-15(18-19)11-6-4-3-5-7-11;/h3-10H,2H2,1H3,(H,17,18);1H