766487-11-0 Usage
Uses
Used in Pharmaceutical Development:
3-(3-Methoxy-benzyl)-piperidine is utilized as a chemical intermediate in the synthesis of various pharmaceutical drugs. Its unique structure and potential pharmacological properties make it a valuable candidate for the development of new medications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 3-(3-Methoxy-benzyl)-piperidine serves as a key component in the design and synthesis of novel compounds with potential therapeutic applications. Researchers use 3-(3-METHOXY-BENZYL)-PIPERIDINE to explore its interactions with biological targets and evaluate its efficacy in treating specific diseases.
Used in Drug Discovery:
3-(3-Methoxy-benzyl)-piperidine is employed in drug discovery processes to identify new lead compounds with potential therapeutic benefits. Its unique chemical structure allows for the development of innovative drugs that can address unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 766487-11-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,6,4,8 and 7 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 766487-11:
(8*7)+(7*6)+(6*6)+(5*4)+(4*8)+(3*7)+(2*1)+(1*1)=210
210 % 10 = 0
So 766487-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO/c1-15-13-6-2-4-11(9-13)8-12-5-3-7-14-10-12/h2,4,6,9,12,14H,3,5,7-8,10H2,1H3
