76691-25-3 Usage
Properties
1. Molecular formula: C18H20ClNO2
2. Synthetic organic compound
3. Potential therapeutic applications
4. Used in research and development settings
5. Derivative of 2-propenamide
6. Contains a chlorophenyl group and a methoxyphenyl group
Specific content
1. Molecular formula: C18H20ClNO2
2. Synthetic organic compound with potential therapeutic applications
3. Used in research and development settings for potential pharmacological properties
4. Contains chlorophenyl and methoxyphenyl groups
5. Subject to further research and testing for specific properties and potential uses
Check Digit Verification of cas no
The CAS Registry Mumber 76691-25-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,6,9 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76691-25:
(7*7)+(6*6)+(5*6)+(4*9)+(3*1)+(2*2)+(1*5)=163
163 % 10 = 3
So 76691-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H20ClNO2/c1-14(13-16-3-7-17(20)8-4-16)19(22)21-12-11-15-5-9-18(23-2)10-6-15/h3-10,13H,11-12H2,1-2H3,(H,21,22)/b14-13+
