768-45-6 Usage
Uses
1. Used in Pharmaceutical Industry:
1-Methyl-5-cyanopyridine-2(1H)-one is used as an active pharmaceutical ingredient for the development of various drugs due to its unique chemical structure and properties.
2. Used in Chemical Research:
1-Methyl-5-cyanopyridine-2(1H)-one serves as a valuable research tool in the field of organic chemistry, particularly for studying the properties and reactions of pyridone alkaloids and their potential applications in various chemical processes.
3. Used in Natural Product Extraction:
1-Methyl-5-cyanopyridine-2(1H)-one is used as a marker compound in the extraction and identification of natural products from plants, such as Trewia nudiflora L., which can help in the discovery of new bioactive compounds with potential therapeutic applications.
4. Used in Synthesis of Derivatives:
1-Methyl-5-cyanopyridine-2(1H)-one can be used as a starting material for the synthesis of various derivatives with potential applications in different industries, such as agrochemicals, dyes, and materials science.
5. Used in Analytical Chemistry:
1-Methyl-5-cyanopyridine-2(1H)-one can be employed as a reference compound in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) and mass spectrometry (MS), for the detection and quantification of similar compounds in complex samples.
References
Mukherjee, Chatterjee., Chern. & Ind., 1524 (1964)
Check Digit Verification of cas no
The CAS Registry Mumber 768-45-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 768-45:
(5*7)+(4*6)+(3*8)+(2*4)+(1*5)=96
96 % 10 = 6
So 768-45-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2O/c1-9-5-6(4-8)2-3-7(9)10/h2-3,5H,1H3
768-45-6Relevant academic research and scientific papers
Kinetic assessment of N-methyl-2-methoxypyridinium species as phosphonate anion methylating agents
Topczewski, Joseph J.,Quinn, Daniel M.
supporting information, p. 1084 - 1087 (2013/04/10)
Organophosphate nerve agents and pesticides are potent inhibitors of acetylcholinesterase (AChE). Although oxime nucleophiles can reactivate the AChE-phosphyl adduct, the adduct undergoes a reaction called aging. No compounds have been described that reactivate the aged-AChE adduct. A family of 2-methoxypyridinium species which reverse aging in a model system is presented. A kinetic study of this system, which includes an SAR analysis, demonstrates that the reaction is highly tunable based on the ring substituents.