76809-63-7 Usage
Uses
Used in Bioconjugation:
BENZOPHENONE-4-IODOACETAMIDE is used as a photocrosslinking agent for bioconjugation, allowing for the specific and efficient attachment of biomolecules, such as proteins, peptides, and nucleic acids, to other molecules or surfaces. This is particularly useful in the development of biosensors, drug delivery systems, and diagnostic tools.
Used in Protein Engineering:
In the field of protein engineering, BENZOPHENONE-4-IODOACETAMIDE is employed as a photocrosslinking agent to introduce new functionalities or to modify the structure and stability of proteins. This can lead to the creation of novel protein-based materials, enzymes with improved catalytic properties, or the development of protein-based therapeutics.
Used in Chemical Biology:
BENZOPHENONE-4-IODOACETAMIDE is utilized as a photocrosslinking agent in chemical biology to study protein-protein interactions, protein-ligand binding, and other molecular recognition events. By covalently linking interacting partners, researchers can gain insights into the mechanisms of biological processes and identify potential drug targets.
Used in Materials Science:
In materials science, BENZOPHENONE-4-IODOACETAMIDE is used as a photocrosslinking agent to create new materials with tailored properties. This can include the development of self-healing materials, stimuli-responsive materials, or materials with enhanced mechanical properties.
Overall, BENZOPHENONE-4-IODOACETAMIDE is a valuable reagent in various scientific and industrial fields, offering a versatile and efficient method for the covalent attachment of molecules through photocrosslinking.
Check Digit Verification of cas no
The CAS Registry Mumber 76809-63-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,0 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 76809-63:
(7*7)+(6*6)+(5*8)+(4*0)+(3*9)+(2*6)+(1*3)=167
167 % 10 = 7
So 76809-63-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H12INO2/c16-10-14(18)17-13-8-6-12(7-9-13)15(19)11-4-2-1-3-5-11/h1-9H,10H2,(H,17,18)
