76823-79-5 Usage
General Description
The chemical "2-[2-[4-[(4-chlorophenyl)benzyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)butyrate dihydrochloride" is a complex compound consisting of several different chemical groups. It contains a piperazine ring, a chlorophenyl group, a benzyl group, an ethoxyethyl group, a benzoylphenyl group, and a butyrate group. Additionally, it is present in the form of a dihydrochloride salt. 2-[2-[4-[(4-chlorophenyl)benzyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)butyrate dihydrochloride may have potential pharmacological effects due to its complex structure, but further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 76823-79-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,2 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 76823-79:
(7*7)+(6*6)+(5*8)+(4*2)+(3*3)+(2*7)+(1*9)=165
165 % 10 = 5
So 76823-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C38H41ClN2O4.2ClH/c1-2-35(32-14-9-15-33(28-32)37(42)31-12-7-4-8-13-31)38(43)45-27-26-44-25-24-40-20-22-41(23-21-40)36(29-10-5-3-6-11-29)30-16-18-34(39)19-17-30;;/h3-19,28,35-36H,2,20-27H2,1H3;2*1H