76824-93-6 Usage
Description
1,2,3,4-Tetrahydro-7-hydroxy-6-methoxy-3-isoquinoline carboxylic acid, also known as tetrahydroisoquinoline-3-carboxylic acid or TIQ-3-CA, is a chemical compound belonging to the isoquinoline family. It has been studied for its potential pharmacological properties, particularly in the field of neuroscience and neurobiology. With its unique structure, it has shown promise as a precursor for the synthesis of various pharmaceutical compounds and indicates possible biological activity. Ongoing research continues to explore its potential applications in medicine and biology.
Uses
Used in Pharmaceutical Industry:
1,2,3,4-Tetrahydro-7-hydroxy-6-methoxy-3-isoquinoline carboxylic acid is used as a precursor for the synthesis of various pharmaceutical compounds due to its unique chemical structure and potential pharmacological properties.
Used in Neuroscience and Neurobiology Research:
1,2,3,4-Tetrahydro-7-hydroxy-6-methoxy-3-isoquinoline carboxylic acid is used as a research compound in the field of neuroscience and neurobiology to explore its potential applications in medicine and biology, given its demonstrated biological activity and potential pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 76824-93-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,2 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 76824-93:
(7*7)+(6*6)+(5*8)+(4*2)+(3*4)+(2*9)+(1*3)=166
166 % 10 = 6
So 76824-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO4/c1-16-10-4-6-2-8(11(14)15)12-5-7(6)3-9(10)13/h3-4,8,12-13H,2,5H2,1H3,(H,14,15)
