768322-42-5 Usage
Uses
Used in Pharmaceutical Development:
(S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid is used as a potential drug candidate for various therapeutic applications due to its unique molecular structure and the presence of functional groups that may facilitate binding to biological targets.
Used in Drug Discovery:
In the field of drug discovery, (S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid is utilized as a starting point for the development of new medications. Its specific structural features, such as the carboxylic acid group and the phenylmethyl group, may allow it to interact with proteins and other molecules in ways that could lead to the modulation of biological processes.
Used in Medicinal Chemistry Research:
(S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid serves as a valuable compound in medicinal chemistry research, where it can be studied for its potential to bind to and modulate the activity of specific receptors or enzymes, contributing to the understanding of disease mechanisms and the development of targeted therapies.
Further research is necessary to fully explore the potential uses and properties of (S)-4,5,6,7-Tetrahydro-3-phenylmethyl-3H-imidazo[4,5-c]pyridine-6-carboxylic acid, as its complex structure and functional groups suggest a wide range of possible applications in the pharmaceutical and medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 768322-42-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,8,3,2 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 768322-42:
(8*7)+(7*6)+(6*8)+(5*3)+(4*2)+(3*2)+(2*4)+(1*2)=185
185 % 10 = 5
So 768322-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N3O2/c18-14(19)12-6-11-13(7-15-12)17(9-16-11)8-10-4-2-1-3-5-10/h1-5,9,12,15H,6-8H2,(H,18,19)/t12-/m0/s1
768322-42-5Relevant academic research and scientific papers
Brana, Miguel F.,Guisado, Cristina,Perez-Castells, Javier,Perez-Serrano, Leticia
, p. 417 - 420 (2002)
The synthesis and evaluation of new ligands for the H3 receptor of histamine is described. These new compounds are diimidazopyridine derivatives readily prepared by a condensation reaction of spinacine and isocyanates.
