7685-67-8 Usage
General Description
N-2-NITROPHENYLSULFENYL-L-LEUCINE is a chemical compound that consists of a nitrophenylsulfenyl group attached to the amino acid L-leucine. It is commonly used as a reagent in the synthesis of various peptides and proteins in the field of biochemistry and pharmaceutical research. The compound is known for its ability to selectively modify cysteine residues in proteins, making it a valuable tool for studying protein structure and function. N-2-NITROPHENYLSULFENYL-L-LEUCINE is also used in the development of potential drug candidates and in the production of novel biomaterials with unique properties. As a versatile and selective chemical reagent, N-2-NITROPHENYLSULFENYL-L-LEUCINE plays a crucial role in various biochemical and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7685-67-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,8 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7685-67:
(6*7)+(5*6)+(4*8)+(3*5)+(2*6)+(1*7)=138
138 % 10 = 8
So 7685-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O4S/c1-8(2)7-9(12(15)16)13-19-11-6-4-3-5-10(11)14(17)18/h3-6,8-9,13H,7H2,1-2H3,(H,15,16)/t9-/m0/s1
