76893-55-5 Usage
Uses
Used in Pharmaceutical Industry:
2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE is used as a building block for the synthesis of various organic compounds, particularly in the development of new pharmaceuticals. Its antifungal and antiproliferative properties have been studied, indicating its potential use in the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE serves as a building block for the synthesis of compounds with pesticidal properties. Its potential biological activities make it a valuable component in the development of new agrochemicals to protect crops and control pests.
Used in Research:
2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE is used as a reference standard for analytical testing in research settings. Its well-defined chemical structure and properties make it suitable for calibrating instruments and validating analytical methods.
Additionally, it is used as a reagent in organic synthesis, facilitating the production of various organic compounds for research and development purposes. Its versatility in chemical reactions and potential applications across different industries highlight the importance of 2-(2,3-DIMETHYLPHENOXY)-3-NITROPYRIDINE in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 76893-55-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,9 and 3 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76893-55:
(7*7)+(6*6)+(5*8)+(4*9)+(3*3)+(2*5)+(1*5)=185
185 % 10 = 5
So 76893-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O3/c1-9-5-3-7-12(10(9)2)18-13-11(15(16)17)6-4-8-14-13/h3-8H,1-2H3
