76939-67-8 Usage
General Description
2-IMINOBIOTIN N-HYDROXYSUCCINIMIDE ESTER is a chemical compound used in bioconjugation reactions for the labeling of biomolecules such as proteins, peptides, and nucleic acids. It is a derivative of biotin, a vitamin that is essential for cell growth, fatty acid production, and the metabolism of amino acids and carbohydrates. The N-hydroxysuccinimide ester group in this compound allows for its efficient and selective conjugation to primary amines in proteins and peptides, making it a valuable tool in various biochemical and molecular biology applications. It is commonly used in techniques such as enzyme-linked immunosorbent assays (ELISA), Western blotting, and immunoprecipitation to detect and characterize specific proteins in biological samples.
Check Digit Verification of cas no
The CAS Registry Mumber 76939-67-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,9,3 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76939-67:
(7*7)+(6*6)+(5*9)+(4*3)+(3*9)+(2*6)+(1*7)=188
188 % 10 = 8
So 76939-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N4O4S/c15-14-16-8-7-23-9(13(8)17-14)3-1-2-4-12(21)22-18-10(19)5-6-11(18)20/h8-9,13H,1-7H2,(H3,15,16,17)