76953-85-0 Usage
General Description
(+-)-N-(3,4,4a,5-Tetrahydro-1H-(1,3)-thiazino(3,4-a)indol-1-ylidene)-5-isoquinolinamine is a complex chemical compound that contains a thiazinoindole structure and an isoquinolinamine group. The thiazinoindole structure consists of a five-membered ring containing a sulfur and nitrogen atom, while the isoquinolinamine group is a derivative of the heterocyclic compound isoquinoline. (+-)-N-(3,4,4a,5-Tetrahydro-1H-(1,3)-thiazino(3,4-a)indol-1-ylidene)-5 -isoquinolinamine has potential pharmaceutical applications due to its structural features and may have biological activity that could be useful in drug development. Further research and studies are required to determine the exact properties and potential uses of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 76953-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,9,5 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76953-85:
(7*7)+(6*6)+(5*9)+(4*5)+(3*3)+(2*8)+(1*5)=180
180 % 10 = 0
So 76953-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H17N3S/c1-2-4-19-15(3-1)12-18-8-10-24-20(23(18)19)22-17-6-5-16-13-21-9-7-14(16)11-17/h1-7,9,11,13,18H,8,10,12H2/b22-20-