76981-87-8 Usage
Uses
Used in Pharmaceutical Research:
2-(2-CHLORO-ACETYLAMINO)-6-METHYL-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID ETHYL ESTER is used as a compound with potential applications in the development of new pharmaceuticals due to its unique structure and pharmacological activities.
Used in Agrochemical Development:
2-(2-CHLORO-ACETYLAMINO)-6-METHYL-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID ETHYL ESTER is used as a compound with potential applications in the development of new agrochemicals, given its unique structure and potential biological activities that may be harnessed for pest control or crop protection.
Check Digit Verification of cas no
The CAS Registry Mumber 76981-87-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,9,8 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76981-87:
(7*7)+(6*6)+(5*9)+(4*8)+(3*1)+(2*8)+(1*7)=188
188 % 10 = 8
So 76981-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18ClNO3S/c1-3-19-14(18)12-9-5-4-8(2)6-10(9)20-13(12)16-11(17)7-15/h8H,3-7H2,1-2H3,(H,16,17)/t8-/m1/s1
