771572-98-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Isoxazolepropanamine,3,5-dimethyl-(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a valuable building block in the development of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-Isoxazolepropanamine,3,5-dimethyl-(9CI) serves as a key component in the design and synthesis of novel bioactive molecules. Its presence in these molecules can influence their pharmacological properties, such as potency, selectivity, and pharmacokinetics, making it an important tool for optimizing drug candidates.
Used in Drug Discovery:
4-Isoxazolepropanamine,3,5-dimethyl-(9CI) is utilized in drug discovery processes to identify and develop new therapeutic agents. Its unique chemical properties and potential interactions with biological targets make it a promising candidate for the treatment of various diseases and disorders.
Used in Chemical Synthesis:
Beyond its applications in the pharmaceutical and medicinal chemistry fields, 4-Isoxazolepropanamine,3,5-dimethyl-(9CI) can also be employed in the synthesis of other organic compounds. Its reactivity and functional groups make it a versatile building block for the creation of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 771572-98-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,1,5,7 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 771572-98:
(8*7)+(7*7)+(6*1)+(5*5)+(4*7)+(3*2)+(2*9)+(1*8)=196
196 % 10 = 6
So 771572-98-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3
