77159-76-3 Usage
Description
4-BROMO-2,6-DIMETHYLPHENYL ISOCYANATE is an organic compound that serves as a crucial building block in the synthesis of various organic molecules and acts as an intermediate in the pharmaceutical industry. Its chemical structure, featuring a bromine atom and isocyanate group, allows for versatile reactivity and functional group manipulation, making it a valuable component in the development of new drugs and organic materials.
Uses
Used in Pharmaceutical Industry:
4-BROMO-2,6-DIMETHYLPHENYL ISOCYANATE is used as a pharmaceutical intermediate for the development of new drugs. Its unique chemical structure allows for the creation of a wide range of therapeutic agents, targeting various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 4-BROMO-2,6-DIMETHYLPHENYL ISOCYANATE is used as a building block for the construction of complex organic molecules. Its reactivity and functional groups enable the formation of diverse chemical structures, which can be further modified and optimized for specific applications.
Used in Chemical Research:
4-BROMO-2,6-DIMETHYLPHENYL ISOCYANATE is also utilized in chemical research to study the reactivity and properties of isocyanate-containing compounds. This research can lead to a better understanding of the underlying chemical mechanisms and the development of new synthetic strategies and methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 77159-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,1,5 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 77159-76:
(7*7)+(6*7)+(5*1)+(4*5)+(3*9)+(2*7)+(1*6)=163
163 % 10 = 3
So 77159-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNO/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3
