77164-02-4 Usage
General Description
O-Methylisourea acetate is a chemical compound that belongs to the class of urea derivatives. It is commonly used as a reagent in organic synthesis and pharmaceutical research. O-METHYLISOUREA ACETATE is a white crystalline solid at room temperature and it is soluble in water and organic solvents. O-Methylisourea acetate is known for its ability to react with a wide range of organic compounds, leading to the formation of various derivatives. It is also used in the production of pharmaceuticals and agrochemicals due to its versatile reactivity and potential biological activity. Additionally, it is employed in the development of new materials and as a building block for the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 77164-02-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,1,6 and 4 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 77164-02:
(7*7)+(6*7)+(5*1)+(4*6)+(3*4)+(2*0)+(1*2)=134
134 % 10 = 4
So 77164-02-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H6N2O.C2H4O2/c1-5-2(3)4;1-2(3)4/h1H3,(H3,3,4);1H3,(H,3,4)
