77215-58-8 Usage
Uses
Used in Pharmaceutical and Agrochemical Production:
N(3)-(bromoacetyl)-2,3-diaminopropanoic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the development of new compounds with specific therapeutic or pesticidal properties.
Used in Antimicrobial Agent Development:
N(3)-(bromoacetyl)-2,3-diaminopropanoic acid is employed as a precursor in the development of antimicrobial agents. Its ability to inhibit certain enzymatic reactions makes it a promising candidate for creating new antibiotics and antifungal agents.
Used in Anticancer Drug Development:
N(3)-(bromoacetyl)-2,3-diaminopropanoic acid is also used in the development of anticancer drugs. Its potential to interfere with specific cellular processes makes it a valuable component in the creation of novel cancer treatments.
Used as a Fluorescent Tag in Biological Research:
In the field of biological research, N(3)-(bromoacetyl)-2,3-diaminopropanoic acid serves as a fluorescent tag. This allows researchers to visually track specific proteins and molecules within living cells, enhancing the understanding of cellular processes and mechanisms.
Used in Chemical Synthesis:
As a reagent in chemical synthesis, N(3)-(bromoacetyl)-2,3-diaminopropanoic acid contributes to the creation of a wide range of chemical compounds, expanding its utility across various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 77215-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,2,1 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 77215-58:
(7*7)+(6*7)+(5*2)+(4*1)+(3*5)+(2*5)+(1*8)=138
138 % 10 = 8
So 77215-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H9BrN2O3/c6-1-4(9)8-2-3(7)5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)
