77229-68-6 Usage
Uses
Used in Pharmaceutical Industry:
Carboxyprimaquine is used as an antimalarial agent for its ability to treat malaria infections. It functions by targeting the Plasmodium parasites responsible for causing the disease, thereby alleviating symptoms and preventing complications.
Additionally, as a Primaquine impurity, Carboxyprimaquine plays a role in the synthesis and production process of Primaquine. Its presence is monitored and controlled to ensure the quality and efficacy of the final antimalarial drug product.
Check Digit Verification of cas no
The CAS Registry Mumber 77229-68-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,2,2 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 77229-68:
(7*7)+(6*7)+(5*2)+(4*2)+(3*9)+(2*6)+(1*8)=156
156 % 10 = 6
So 77229-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O3/c1-10(5-6-14(18)19)17-13-9-12(20-2)8-11-4-3-7-16-15(11)13/h3-4,7-10,17H,5-6H2,1-2H3,(H,18,19)
