772327-44-3 Usage
Uses
Used in Organic Synthesis:
5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is used as a building block in organic synthesis for creating more complex molecules. Its unique structure allows for the formation of various chemical entities, contributing to the development of new compounds with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is utilized as a key component in the design and synthesis of pharmaceutical agents. Its presence in molecules can influence their biological activity, making it a valuable asset in drug discovery and development processes.
Used in Pharmaceutical Research and Development:
5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) is of interest in pharmaceutical research and development due to its potential biological activities. Researchers explore its interactions with biological targets to identify new therapeutic opportunities and advance the understanding of its pharmacological profile.
Used in Chemical Intermediates for Drug Production:
As a chemical intermediate, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) plays a crucial role in the production of various drugs. Its reactivity and structural features enable the synthesis of pharmaceutical compounds with desired therapeutic effects.
Used in Biochemical Research:
In biochemical research, 5(4H)-Oxazolone,2-(aminomethyl)-4-methyl-(9CI) may be employed to study its interactions with enzymes, receptors, or other biomolecules. This research can provide insights into its mechanism of action and potential applications in treating specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 772327-44-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,2,3,2 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 772327-44:
(8*7)+(7*7)+(6*2)+(5*3)+(4*2)+(3*7)+(2*4)+(1*4)=173
173 % 10 = 3
So 772327-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N2O2/c1-3-5(8)9-4(2-6)7-3/h3H,2,6H2,1H3
