77249-34-4 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Dimethyl-4-fluorophenol is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 2,3-Dimethyl-4-fluorophenol serves as a versatile building block for the creation of a wide range of organic compounds. Its reactivity and functional groups make it a valuable component in the synthesis of various chemical products.
Used in Antimicrobial Applications:
Leveraging its antimicrobial properties, 2,3-Dimethyl-4-fluorophenol is employed as a preservative and disinfectant in various industrial and commercial applications. It helps to inhibit the growth of microorganisms, ensuring the safety and longevity of products in diverse sectors such as cosmetics, food processing, and healthcare.
Used in Research and Development:
2,3-Dimethyl-4-fluorophenol is utilized in research and development settings to explore its potential applications and properties. Scientists and researchers investigate its chemical behavior, reactivity, and interactions with other compounds to discover new uses and improve existing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 77249-34-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,2,4 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 77249-34:
(7*7)+(6*7)+(5*2)+(4*4)+(3*9)+(2*3)+(1*4)=154
154 % 10 = 4
So 77249-34-4 is a valid CAS Registry Number.
InChI:InChI=1S/C8H9FO/c1-5-6(2)8(10)4-3-7(5)9/h3-4,10H,1-2H3
