773131-96-7 Usage
Uses
Used in Pharmaceutical Research:
3-(4-Aminopyridin-3-yl)acrylic acid is used as a building block in organic synthesis for the development of new compounds with potential biological activity. Its unique structure allows for the creation of novel molecules that can be further explored for their therapeutic properties.
Used in Drug Discovery:
3-(4-Aminopyridin-3-yl)acrylic acid is used as a key component in the development of new drugs and therapeutic agents. Its presence in various chemical structures can contribute to the discovery of innovative treatments for a range of medical conditions.
Used in Medicinal Chemistry:
3-(4-Aminopyridin-3-yl)acrylic acid is used as a research tool in medicinal chemistry to understand the interactions between molecules and their biological targets. This knowledge can be applied to design more effective drugs and therapies.
Used in Chemical Synthesis:
3-(4-Aminopyridin-3-yl)acrylic acid is used as a reagent in chemical synthesis processes to create a variety of compounds with different applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 773131-96-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,3,1,3 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 773131-96:
(8*7)+(7*7)+(6*3)+(5*1)+(4*3)+(3*1)+(2*9)+(1*6)=167
167 % 10 = 7
So 773131-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O2/c9-7-3-4-10-5-6(7)1-2-8(11)12/h1-5H,(H2,9,10)(H,11,12)
