773140-43-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyridinecarboxylic acid, 4-amino-, ethylester (9CI) is used as a reagent for the preparation of bicyclic pyrimidines. These bicyclic pyrimidines serve as inhibitors of transforming growth factor-β (TGF-β), which plays a crucial role in various cellular processes, including cell proliferation, differentiation, and migration. Inhibiting TGF-β can be beneficial in the development of treatments for diseases characterized by excessive cell growth or scarring, such as cancer and fibrosis.
Check Digit Verification of cas no
The CAS Registry Mumber 773140-43-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,3,1,4 and 0 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 773140-43:
(8*7)+(7*7)+(6*3)+(5*1)+(4*4)+(3*0)+(2*4)+(1*3)=155
155 % 10 = 5
So 773140-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-2-12-8(11)7-5-6(9)3-4-10-7/h3-5H,2H2,1H3,(H2,9,10)
