77440-13-2 Usage
Uses
Used in Pharmaceutical Industry:
N(5)-methyl-N(5)-formyl-2,5,6-triamino-4-hydroxypyrimidine is used as an active pharmaceutical ingredient for the development of novel therapeutic agents. Its unique structure allows for the modulation of various biological pathways, making it a promising candidate for the treatment of specific diseases.
Used in Chemical Research:
In the field of chemical research, N(5)-methyl-N(5)-formyl-2,5,6-triamino-4-hydroxypyrimidine serves as a key intermediate in the synthesis of more complex molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Material Science:
N(5)-methyl-N(5)-formyl-2,5,6-triamino-4-hydroxypyrimidine can be utilized as a building block for the development of new materials with unique properties, such as enhanced stability, improved conductivity, or specific interactions with other molecules. These materials could find applications in areas like electronics, sensors, and energy storage.
Used in Diagnostics:
N(5)-methyl-N(5)-formyl-2,5,6-triamino-4-hydroxypyrimidine's ability to interact with various biological molecules makes it a potential candidate for use in diagnostic tools, where it could be employed as a probe or marker to detect specific biological targets or monitor certain biochemical processes.
Used in Drug Delivery Systems:
Similar to gallotannin, N(5)-methyl-N(5)-formyl-2,5,6-triamino-4-hydroxypyrimidine could be incorporated into drug delivery systems to improve the bioavailability and therapeutic efficacy of other drugs. Its unique structural features may allow for targeted delivery or controlled release of active pharmaceutical ingredients.
Check Digit Verification of cas no
The CAS Registry Mumber 77440-13-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,4,4 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77440-13:
(7*7)+(6*7)+(5*4)+(4*4)+(3*0)+(2*1)+(1*3)=132
132 % 10 = 2
So 77440-13-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N5O2/c1-11(2-12)3-4(7)9-6(8)10-5(3)13/h2H,1H3,(H5,7,8,9,10,13)
