774603-04-2 Usage
Description
(9E,12Z)-10-Nitrooctadecadienoic acid, also known as 10-Nitrolinoleate, is a nitrated fatty acid that acts as a peroxisome proliferator-activated receptor γ (PPARγ) agonist. It is derived from linoleic acid through a process involving exposure to acidified nitrite, resulting in a molecule with potential applications in various fields due to its unique properties and interactions with cellular receptors.
Uses
Used in Pharmaceutical Industry:
(9E,12Z)-10-Nitrooctadecadienoic acid is used as a therapeutic agent for the treatment of various diseases, particularly those related to inflammation and metabolic disorders. As a PPARγ agonist, it modulates the activity of this nuclear receptor, which plays a crucial role in the regulation of cellular differentiation, inflammation, and lipid and glucose homeostasis. This makes it a promising candidate for the development of drugs targeting conditions such as type 2 diabetes, atherosclerosis, and obesity.
Used in Research Applications:
In the field of scientific research, (9E,12Z)-10-Nitrooctadecadienoic acid serves as an important tool for studying the role of PPARγ in cellular processes and disease mechanisms. It can be used to investigate the effects of PPARγ activation on gene expression, cellular signaling pathways, and the development of various pathologies. This knowledge can contribute to the understanding of disease etiology and the identification of novel therapeutic targets.
Used in Drug Development:
(9E,12Z)-10-Nitrooctadecadienoic acid is utilized in the development of new drugs targeting PPARγ, which may have applications in treating a range of diseases beyond metabolic disorders. Its use in drug development can lead to the creation of more effective and targeted therapies with fewer side effects, as it allows researchers to explore the potential of PPARγ agonism in various disease contexts.
Used in Chemical Synthesis:
In the chemical industry, (9E,12Z)-10-Nitrooctadecadienoic acid may be employed as a starting material or intermediate in the synthesis of other bioactive compounds or pharmaceuticals. Its unique structure and functional groups can be further modified or used to create novel molecules with specific biological activities, expanding the scope of its applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 774603-04-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,4,6,0 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 774603-04:
(8*7)+(7*7)+(6*4)+(5*6)+(4*0)+(3*3)+(2*0)+(1*4)=172
172 % 10 = 2
So 774603-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H31NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h8,11,15H,2-7,9-10,12-14,16H2,1H3,(H,20,21)/b11-8-,17-15+
774603-04-2Relevant articles and documents
Stereocontrolled synthesis of the PPAR-γ agonist 10-nitrolinoleic acid
Dunny, Elizabeth,Evans, Paul
supporting information; experimental part, p. 5334 - 5336 (2010/10/19)
(Figure presented) The naturally occurring PPAR-γ ligand 10-nitrooctadeca-9(E),12(Z)-dienoic acid (10-nitrolinoleic acid) (2a) was prepared as a single regio- and geometrical isomer in a practical eight-step, convergent sequence. The synthetic route featured a nitro aldol reaction between 9-oxononanoic acid methyl ester (3) and 1-nitronon-3(Z)-ene (4) in the key carbon-carbon bond forming step. The ability of 2a (and its methyl ester 9) to bind to PPAR-γ in a ligand-binding assay is reported.
