774608-89-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is used as a key intermediate in the synthesis of new drugs and pharmaceutical compounds. Its unique structure and functional groups contribute to the development of innovative therapeutic agents with potential applications in various medical fields.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Bromo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is employed as a building block in the production of agrochemicals. Its versatile reactivity allows for the creation of compounds with potential applications in crop protection, pest control, and other agricultural areas.
Used in Organic Synthesis:
5-Bromo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is used as a reagent in research laboratories for various organic synthesis reactions. Its unique properties make it a valuable component in the development of heterocyclic compounds and other complex organic molecules.
Used in Research and Development:
5-BROMO-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID ETHYL ESTER is utilized in research and development efforts to explore its potential applications and properties. Its unique structure and reactivity make it an interesting subject for scientific investigation, potentially leading to new discoveries and advancements in various fields.
Used in Chemical Production:
5-Bromo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is employed in the production of various chemical products, including intermediates for further synthesis and final products with specific applications. Its versatility and reactivity contribute to the development of a wide range of chemical compounds with diverse uses.
Check Digit Verification of cas no
The CAS Registry Mumber 774608-89-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,4,6,0 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 774608-89:
(8*7)+(7*7)+(6*4)+(5*6)+(4*0)+(3*8)+(2*8)+(1*9)=208
208 % 10 = 8
So 774608-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H6BrN3O2/c1-2-11-4(10)3-7-5(6)9-8-3/h2H2,1H3,(H,7,8,9)
