774608-90-1 Usage
General Description
5-Iodo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is a chemical compound that belongs to the class of triazole derivatives. It is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 5-Iodo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is known for its antimicrobial, antifungal, and herbicidal properties. It has also been studied for its potential use in the treatment of cancer due to its ability to inhibit the growth of cancer cells. Additionally, 5-Iodo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester has been investigated for its potential use as a building block in organic synthesis and as a ligand in coordination chemistry. Overall, this chemical compound has a wide range of potential applications in various fields including medicine, agriculture, and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 774608-90-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,4,6,0 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 774608-90:
(8*7)+(7*7)+(6*4)+(5*6)+(4*0)+(3*8)+(2*9)+(1*0)=201
201 % 10 = 1
So 774608-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H6IN3O2/c1-2-11-4(10)3-7-5(6)9-8-3/h2H2,1H3,(H,7,8,9)
