77523-56-9 Usage
Uses
Used in Pharmaceutical Industry:
Ethanone, 1-(7-methoxynaphtho(2,1-b)furan-2-yl)is employed as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved therapeutic properties and reduced side effects. Ethanone, 1-(7-methoxynaphtho(2,1-b)furan-2-yl)-'s versatility in chemical reactions enables the creation of diverse drug candidates with potential applications in treating various diseases and medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, Ethanone, 1-(7-methoxynaphtho(2,1-b)furan-2-yl)serves as a crucial building block for the synthesis of novel agrochemicals. Its structural features contribute to the development of innovative pesticides, herbicides, and other agricultural chemicals that can enhance crop protection and yield while minimizing environmental impact.
Used in Research and Development:
Ethanone, 1-(7-methoxynaphtho(2,1-b)furan-2-yl)is extensively utilized in research and development laboratories for the exploration of new chemical reactions and synthesis pathways. Its unique structural features make it an ideal candidate for studying the reactivity and selectivity of various chemical transformations, leading to the discovery of new synthetic methods and the development of more efficient and sustainable chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 77523-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,5,2 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 77523-56:
(7*7)+(6*7)+(5*5)+(4*2)+(3*3)+(2*5)+(1*6)=149
149 % 10 = 9
So 77523-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O3/c1-9(16)14-8-12-5-11-6-13(17-2)4-3-10(11)7-15(12)18-14/h3-8H,1-2H3
