7758-33-0 Usage
Uses
Used in Research:
H-GLY-HIS-GLY-OH is used as a research tool for studying the structure, function, and interactions of peptides and amino acids in biological systems. Its unique sequence allows researchers to investigate the role of specific amino acids in peptide folding, stability, and biological activity.
Used in Pharmaceutical Industry:
H-GLY-HIS-GLY-OH is used as a potential therapeutic agent for various medical conditions. The presence of histidine, an essential amino acid, may contribute to its potential in tissue growth and repair, as well as red blood cell formation. Additionally, glycine's role as a neurotransmitter in the central nervous system suggests potential applications in neurological disorders.
Used in Biotechnology:
H-GLY-HIS-GLY-OH is used as a component in the development of novel biotechnological products, such as biosensors, drug delivery systems, and diagnostic tools. Its unique properties and the functions of its constituent amino acids make it a valuable candidate for these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7758-33-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,7,5 and 8 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7758-33:
(6*7)+(5*7)+(4*5)+(3*8)+(2*3)+(1*3)=130
130 % 10 = 0
So 7758-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N5O4/c11-2-8(16)15-7(1-6-3-12-5-14-6)10(19)13-4-9(17)18/h3,5,7H,1-2,4,11H2,(H,12,14)(H,13,19)(H,15,16)(H,17,18)
