77587-70-3 Usage
Uses
1. Used in Medicinal Chemistry:
1-((4,5-Dihydro-1H-imidazol-2-yl)(1H-indol-3-ylmethyl)amino)-1-butanol monohydroiodide is used as a compound in medicinal chemistry for its unique structure and properties. Its potential applications may include the development of new drugs or therapies, targeting specific biological pathways or receptors.
2. Used in Pharmacology:
In the field of pharmacology, 1-((4,5-Dihydro-1H-imidazol-2-yl)(1H-indol-3-ylmethyl)amino)-1-butanol monohydroiodide is used as a compound for further research and testing. Its complex structure may offer insights into the development of novel therapeutic agents or contribute to the understanding of certain biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 77587-70-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,5,8 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 77587-70:
(7*7)+(6*7)+(5*5)+(4*8)+(3*7)+(2*7)+(1*0)=183
183 % 10 = 3
So 77587-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N4O.HI/c1-2-5-15(21)20(16-17-8-9-18-16)11-12-10-19-14-7-4-3-6-13(12)14;/h3-4,6-7,10,15,19,21H,2,5,8-9,11H2,1H3,(H,17,18);1H
