77587-85-0 Usage
Chemical structure
The compound is a hydriodide salt derivative of 1-Propanol, 3-(N-(2-imidazolin-2-yl)-N-(2-(p-methoxyphenyl)-3-indolylmethyl)amino)-. This means that it has a 1-Propanol backbone with a 3-(N-(2-imidazolin-2-yl)-N-(2-(p-methoxyphenyl)-3-indolylmethyl)amino)functional group attached to it, and a hydriodide ion (I-) as the counterion.
Pharmaceutical compound
The compound is used as a pharmaceutical compound, which means it has potential applications in the medical field. It is specifically being researched for its potential anti-hypertensive and anti-arrhythmic activities.
Alpha-2 adrenergic agonist
The compound acts as an alpha-2 adrenergic agonist, which means it can activate the alpha-2 adrenergic receptors in the body. Activation of these receptors can lead to various physiological effects, such as vasoconstriction and reduced heart rate, which may contribute to its potential anti-hypertensive and anti-arrhythmic activities.
Cardiovascular system studies
The compound has been used in various studies related to the cardiovascular system, including the potential treatment of hypertension and arrhythmias. This suggests that it may have therapeutic potential in managing these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 77587-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,5,8 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 77587-85:
(7*7)+(6*7)+(5*5)+(4*8)+(3*7)+(2*8)+(1*5)=190
190 % 10 = 0
So 77587-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O2.HI/c1-28-17-9-7-16(8-10-17)21-19(18-5-2-3-6-20(18)25-21)15-26(13-4-14-27)22-23-11-12-24-22;/h2-3,5-10,25,27H,4,11-15H2,1H3,(H,23,24);1H